C21H19F3N2O2 — CID 175986752
4-(3-hydroxyphenyl)-N-propyl-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide (PubChem CID 175986752) has the molecular formula C21H19F3N2O2 and a molecular weight of 388.39 g/mol. Its IUPAC name is 4-(3-hydroxyphenyl)-N-propyl-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 4-(3-hydroxyphenyl)-N-propyl-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 175986752 |
| Molecular Formula | C21H19F3N2O2 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 4-(3-hydroxyphenyl)-N-propyl-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide |
| SMILES | CCCNC(=O)c1c[nH]c(-c2ccc(C(F)(F)F)cc2)c1-c1cccc(O)c1 |
| InChI | InChI=1S/C21H19F3N2O2/c1-2-10-25-20(28)17-12-26-19(18(17)14-4-3-5-16(27)11-14)13-6-8-15(9-7-13)21(22,23)24/h3-9,11-12,26-27H,2,10H2,1H3,(H,25,28) |
| InChIKey | NJWDFABTXGGNMH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |