C21H18F3NO3 — CID 175986809
ethyl 4-(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxylate (PubChem CID 175986809) has the molecular formula C21H18F3NO3 and a molecular weight of 389.37 g/mol. Its IUPAC name is ethyl 4-(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 4-(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 175986809 |
| Molecular Formula | C21H18F3NO3 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | ethyl 4-(4-methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c(-c2ccc(C(F)(F)F)cc2)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H18F3NO3/c1-3-28-20(26)17-12-25-19(14-4-8-15(9-5-14)21(22,23)24)18(17)13-6-10-16(27-2)11-7-13/h4-12,25H,3H2,1-2H3 |
| InChIKey | MBNHKDGFTLMMLC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |