C21H18F3NO3S — CID 175986756
ethyl 4-(3-methylsulfinylphenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxylate (PubChem CID 175986756) has the molecular formula C21H18F3NO3S and a molecular weight of 421.44 g/mol. Its IUPAC name is ethyl 4-(3-methylsulfinylphenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 4-(3-methylsulfinylphenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 175986756 |
| Molecular Formula | C21H18F3NO3S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | ethyl 4-(3-methylsulfinylphenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c(-c2ccc(C(F)(F)F)cc2)c1-c1cccc(S(C)=O)c1 |
| InChI | InChI=1S/C21H18F3NO3S/c1-3-28-20(26)17-12-25-19(13-7-9-15(10-8-13)21(22,23)24)18(17)14-5-4-6-16(11-14)29(2)27/h4-12,25H,3H2,1-2H3 |
| InChIKey | HHBSTJVHDXGQJV-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |