C21H15F3N2O2 — CID 175986795
ethyl 4-(3-cyanophenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxylate (PubChem CID 175986795) has the molecular formula C21H15F3N2O2 and a molecular weight of 384.36 g/mol. Its IUPAC name is ethyl 4-(3-cyanophenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 4-(3-cyanophenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 175986795 |
| Molecular Formula | C21H15F3N2O2 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | ethyl 4-(3-cyanophenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c(-c2ccc(C(F)(F)F)cc2)c1-c1cccc(C#N)c1 |
| InChI | InChI=1S/C21H15F3N2O2/c1-2-28-20(27)17-12-26-19(14-6-8-16(9-7-14)21(22,23)24)18(17)15-5-3-4-13(10-15)11-25/h3-10,12,26H,2H2,1H3 |
| InChIKey | SXVNWFHQARFVLX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |