C13H10N2O3 — CID 23465061
ethyl 3-(3-cyanophenyl)-1,2-oxazole-4-carboxylate (PubChem CID 23465061) has the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. Its IUPAC name is ethyl 3-(3-cyanophenyl)-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 3-(3-cyanophenyl)-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 23465061 |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | ethyl 3-(3-cyanophenyl)-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1conc1-c1cccc(C#N)c1 |
| InChI | InChI=1S/C13H10N2O3/c1-2-17-13(16)11-8-18-15-12(11)10-5-3-4-9(6-10)7-14/h3-6,8H,2H2,1H3 |
| InChIKey | ONKWRMKPKOHPKP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 76.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |