C22H23F3N4O — CID 175986707
4-(4-aminophenyl)-N-[2-(dimethylamino)ethyl]-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide (PubChem CID 175986707) has the molecular formula C22H23F3N4O and a molecular weight of 416.45 g/mol. Its IUPAC name is 4-(4-aminophenyl)-N-[2-(dimethylamino)ethyl]-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 4-(4-aminophenyl)-N-[2-(dimethylamino)ethyl]-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 175986707 |
| Molecular Formula | C22H23F3N4O |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 4-(4-aminophenyl)-N-[2-(dimethylamino)ethyl]-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide |
| SMILES | CN(C)CCNC(=O)c1c[nH]c(-c2ccc(C(F)(F)F)cc2)c1-c1ccc(N)cc1 |
| InChI | InChI=1S/C22H23F3N4O/c1-29(2)12-11-27-21(30)18-13-28-20(19(18)14-5-9-17(26)10-6-14)15-3-7-16(8-4-15)22(23,24)25/h3-10,13,28H,11-12,26H2,1-2H3,(H,27,30) |
| InChIKey | ATOWYOFWRNPORH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|