C12H14F3IN2O — CID 172648729
N-[2-(dimethylamino)ethyl]-2-iodo-5-(trifluoromethyl)benzamide (PubChem CID 172648729) has the molecular formula C12H14F3IN2O and a molecular weight of 386.16 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-iodo-5-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-iodo-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 172648729 |
| Molecular Formula | C12H14F3IN2O |
| Molecular Weight | 386.16 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-iodo-5-(trifluoromethyl)benzamide |
| SMILES | CN(C)CCNC(=O)c1cc(C(F)(F)F)ccc1I |
| InChI | InChI=1S/C12H14F3IN2O/c1-18(2)6-5-17-11(19)9-7-8(12(13,14)15)3-4-10(9)16/h3-4,7H,5-6H2,1-2H3,(H,17,19) |
| InChIKey | WAOMZBYTHGTYLH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.16 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|