C23H15F3N4O3 — CID 175986791
4-(2-nitrophenyl)-N-pyridin-2-yl-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide (PubChem CID 175986791) has the molecular formula C23H15F3N4O3 and a molecular weight of 452.39 g/mol. Its IUPAC name is 4-(2-nitrophenyl)-N-pyridin-2-yl-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 4-(2-nitrophenyl)-N-pyridin-2-yl-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 175986791 |
| Molecular Formula | C23H15F3N4O3 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 4-(2-nitrophenyl)-N-pyridin-2-yl-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide |
| SMILES | O=C(Nc1ccccn1)c1c[nH]c(-c2ccc(C(F)(F)F)cc2)c1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H15F3N4O3/c24-23(25,26)15-10-8-14(9-11-15)21-20(16-5-1-2-6-18(16)30(32)33)17(13-28-21)22(31)29-19-7-3-4-12-27-19/h1-13,28H,(H,27,29,31) |
| InChIKey | ONRFWWHXPPAXBM-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|