C26H18F3N3O4 — CID 175523658
4-(4-acetylphenyl)-2-(2-nitrophenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide (PubChem CID 175523658) has the molecular formula C26H18F3N3O4 and a molecular weight of 493.44 g/mol. Its IUPAC name is 4-(4-acetylphenyl)-2-(2-nitrophenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 4-(4-acetylphenyl)-2-(2-nitrophenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 175523658 |
| Molecular Formula | C26H18F3N3O4 |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 4-(4-acetylphenyl)-2-(2-nitrophenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide |
| SMILES | CC(=O)c1ccc(-c2c(-c3ccc(C(F)(F)F)cc3)[nH]c(-c3ccccc3[N+](=O)[O-])c2C(N)=O)cc1 |
| InChI | InChI=1S/C26H18F3N3O4/c1-14(33)15-6-8-16(9-7-15)21-22(25(30)34)24(19-4-2-3-5-20(19)32(35)36)31-23(21)17-10-12-18(13-11-17)26(27,28)29/h2-13,31H,1H3,(H2,30,34) |
| InChIKey | ZQENWMINFZSCCE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|