C29H24F3N3O3 — CID 170695561
[2-(2-nitrophenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]-(4-piperidin-1-ylphenyl)methanone (PubChem CID 170695561) has the molecular formula C29H24F3N3O3 and a molecular weight of 519.52 g/mol. Its IUPAC name is [2-(2-nitrophenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]-(4-piperidin-1-ylphenyl)methanone.
| Compound Name | [2-(2-nitrophenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]-(4-piperidin-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 170695561 |
| Molecular Formula | C29H24F3N3O3 |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | [2-(2-nitrophenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]-(4-piperidin-1-ylphenyl)methanone |
| SMILES | O=C(c1ccc(N2CCCCC2)cc1)c1cc(-c2ccc(C(F)(F)F)cc2)[nH]c1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H24F3N3O3/c30-29(31,32)21-12-8-19(9-13-21)25-18-24(27(33-25)23-6-2-3-7-26(23)35(37)38)28(36)20-10-14-22(15-11-20)34-16-4-1-5-17-34/h2-3,6-15,18,33H,1,4-5,16-17H2 |
| InChIKey | PJEOQWUJNOKFRX-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|