C25H26F3N5O4 — CID 170695509
N-[2-(4-methylpiperazin-1-yl)ethyl]-2-(2-nitrophenyl)-5-[3-(trifluoromethoxy)phenyl]-1H-pyrrole-3-carboxamide (PubChem CID 170695509) has the molecular formula C25H26F3N5O4 and a molecular weight of 517.51 g/mol. Its IUPAC name is N-[2-(4-methylpiperazin-1-yl)ethyl]-2-(2-nitrophenyl)-5-[3-(trifluoromethoxy)phenyl]-1H-pyrrole-3-carboxamide.
| Compound Name | N-[2-(4-methylpiperazin-1-yl)ethyl]-2-(2-nitrophenyl)-5-[3-(trifluoromethoxy)phenyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 170695509 |
| Molecular Formula | C25H26F3N5O4 |
| Molecular Weight | 517.51 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | N-[2-(4-methylpiperazin-1-yl)ethyl]-2-(2-nitrophenyl)-5-[3-(trifluoromethoxy)phenyl]-1H-pyrrole-3-carboxamide |
| SMILES | CN1CCN(CCNC(=O)c2cc(-c3cccc(OC(F)(F)F)c3)[nH]c2-c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C25H26F3N5O4/c1-31-11-13-32(14-12-31)10-9-29-24(34)20-16-21(17-5-4-6-18(15-17)37-25(26,27)28)30-23(20)19-7-2-3-8-22(19)33(35)36/h2-8,15-16,30H,9-14H2,1H3,(H,29,34) |
| InChIKey | WXXUCJBDKJXTHR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 103.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|