C27H34N4O3 — CID 170695582
5-(4-tert-butylphenyl)-N-[2-(diethylamino)ethyl]-2-(2-nitrophenyl)-1H-pyrrole-3-carboxamide (PubChem CID 170695582) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-N-[2-(diethylamino)ethyl]-2-(2-nitrophenyl)-1H-pyrrole-3-carboxamide.
| Compound Name | 5-(4-tert-butylphenyl)-N-[2-(diethylamino)ethyl]-2-(2-nitrophenyl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 170695582 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 5-(4-tert-butylphenyl)-N-[2-(diethylamino)ethyl]-2-(2-nitrophenyl)-1H-pyrrole-3-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(-c2ccc(C(C)(C)C)cc2)[nH]c1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H34N4O3/c1-6-30(7-2)17-16-28-26(32)22-18-23(19-12-14-20(15-13-19)27(3,4)5)29-25(22)21-10-8-9-11-24(21)31(33)34/h8-15,18,29H,6-7,16-17H2,1-5H3,(H,28,32) |
| InChIKey | VRJFSAREVFVBJS-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|