C25H25F3N4O3 — CID 170695533
[2-(2-nitrophenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]-(4-propan-2-ylpiperazin-1-yl)methanone (PubChem CID 170695533) has the molecular formula C25H25F3N4O3 and a molecular weight of 486.49 g/mol. Its IUPAC name is [2-(2-nitrophenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]-(4-propan-2-ylpiperazin-1-yl)methanone.
| Compound Name | [2-(2-nitrophenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]-(4-propan-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 170695533 |
| Molecular Formula | C25H25F3N4O3 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | [2-(2-nitrophenyl)-5-[4-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]-(4-propan-2-ylpiperazin-1-yl)methanone |
| SMILES | CC(C)N1CCN(C(=O)c2cc(-c3ccc(C(F)(F)F)cc3)[nH]c2-c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C25H25F3N4O3/c1-16(2)30-11-13-31(14-12-30)24(33)20-15-21(17-7-9-18(10-8-17)25(26,27)28)29-23(20)19-5-3-4-6-22(19)32(34)35/h3-10,15-16,29H,11-14H2,1-2H3 |
| InChIKey | CAMWYDMGZLXBCD-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 82.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|