C23H24N2O4 — CID 170695588
ethyl 5-(4-tert-butylphenyl)-2-(2-nitrophenyl)-1H-pyrrole-3-carboxylate (PubChem CID 170695588) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is ethyl 5-(4-tert-butylphenyl)-2-(2-nitrophenyl)-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-(4-tert-butylphenyl)-2-(2-nitrophenyl)-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 170695588 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | ethyl 5-(4-tert-butylphenyl)-2-(2-nitrophenyl)-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(C(C)(C)C)cc2)[nH]c1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H24N2O4/c1-5-29-22(26)18-14-19(15-10-12-16(13-11-15)23(2,3)4)24-21(18)17-8-6-7-9-20(17)25(27)28/h6-14,24H,5H2,1-4H3 |
| InChIKey | LTBNGAXFIPNVFC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|