C21H31N3O — CID 91067817
N-[2-(diethylamino)ethyl]-2-methyl-5-(2-propan-2-ylphenyl)-1H-pyrrole-3-carboxamide (PubChem CID 91067817) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2-methyl-5-(2-propan-2-ylphenyl)-1H-pyrrole-3-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-2-methyl-5-(2-propan-2-ylphenyl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 91067817 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2-methyl-5-(2-propan-2-ylphenyl)-1H-pyrrole-3-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(-c2ccccc2C(C)C)[nH]c1C |
| InChI | InChI=1S/C21H31N3O/c1-6-24(7-2)13-12-22-21(25)19-14-20(23-16(19)5)18-11-9-8-10-17(18)15(3)4/h8-11,14-15,23H,6-7,12-13H2,1-5H3,(H,22,25) |
| InChIKey | LGSUOIHLBNWRFG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |