C24H21F3N4O3 — CID 157351678
1-(2-nitro-5-piperidin-1-ylphenyl)-2-[2-[3-(trifluoromethyl)phenyl]pyrimidin-5-yl]ethanone (PubChem CID 157351678) has the molecular formula C24H21F3N4O3 and a molecular weight of 470.45 g/mol. Its IUPAC name is 1-(2-nitro-5-piperidin-1-ylphenyl)-2-[2-[3-(trifluoromethyl)phenyl]pyrimidin-5-yl]ethanone.
| Compound Name | 1-(2-nitro-5-piperidin-1-ylphenyl)-2-[2-[3-(trifluoromethyl)phenyl]pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 157351678 |
| Molecular Formula | C24H21F3N4O3 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 1-(2-nitro-5-piperidin-1-ylphenyl)-2-[2-[3-(trifluoromethyl)phenyl]pyrimidin-5-yl]ethanone |
| SMILES | O=C(Cc1cnc(-c2cccc(C(F)(F)F)c2)nc1)c1cc(N2CCCCC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H21F3N4O3/c25-24(26,27)18-6-4-5-17(12-18)23-28-14-16(15-29-23)11-22(32)20-13-19(7-8-21(20)31(33)34)30-9-2-1-3-10-30/h4-8,12-15H,1-3,9-11H2 |
| InChIKey | SNQYYLDIJWXKKS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 89.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|