C29H26F4N4 — CID 67016120
2-[(4-fluorophenyl)methyl]-4-[(4-piperidin-1-ylphenyl)methyl]-6-[3-(trifluoromethyl)phenyl]-1,3,5-triazine (PubChem CID 67016120) has the molecular formula C29H26F4N4 and a molecular weight of 506.55 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-4-[(4-piperidin-1-ylphenyl)methyl]-6-[3-(trifluoromethyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-[(4-fluorophenyl)methyl]-4-[(4-piperidin-1-ylphenyl)methyl]-6-[3-(trifluoromethyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 67016120 |
| Molecular Formula | C29H26F4N4 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-4-[(4-piperidin-1-ylphenyl)methyl]-6-[3-(trifluoromethyl)phenyl]-1,3,5-triazine |
| SMILES | Fc1ccc(Cc2nc(Cc3ccc(N4CCCCC4)cc3)nc(-c3cccc(C(F)(F)F)c3)n2)cc1 |
| InChI | InChI=1S/C29H26F4N4/c30-24-11-7-20(8-12-24)17-26-34-27(18-21-9-13-25(14-10-21)37-15-2-1-3-16-37)36-28(35-26)22-5-4-6-23(19-22)29(31,32)33/h4-14,19H,1-3,15-18H2 |
| InChIKey | IDCMPGVAUIPGSA-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|