C24H24N2O7P+ — CID 57015536
methyl 5-(2-hydroxy-5-phenyl-1,3,2-dioxaphosphinan-2-ium-2-yl)-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate (PubChem CID 57015536) has the molecular formula C24H24N2O7P+ and a molecular weight of 483.44 g/mol. Its IUPAC name is methyl 5-(2-hydroxy-5-phenyl-1,3,2-dioxaphosphinan-2-ium-2-yl)-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate.
| Compound Name | methyl 5-(2-hydroxy-5-phenyl-1,3,2-dioxaphosphinan-2-ium-2-yl)-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 57015536 |
| Molecular Formula | C24H24N2O7P+ |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | methyl 5-(2-hydroxy-5-phenyl-1,3,2-dioxaphosphinan-2-ium-2-yl)-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(C)nc(C)c([P+]2(O)OCC(c3ccccc3)CO2)c1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H24N2O7P/c1-15-21(24(27)31-3)22(19-11-7-8-12-20(19)26(28)29)23(16(2)25-15)34(30)32-13-18(14-33-34)17-9-5-4-6-10-17/h4-12,18,30H,13-14H2,1-3H3/q+1 |
| InChIKey | KDGNRGNYTUWCGP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|