C30H35N3O8 — CID 14580326
dimethyl 2,6-dimethyl-4-[5-nitro-2-[4-(3-phenoxypropylamino)butoxy]phenyl]pyridine-3,5-dicarboxylate (PubChem CID 14580326) has the molecular formula C30H35N3O8 and a molecular weight of 565.62 g/mol. Its IUPAC name is dimethyl 2,6-dimethyl-4-[5-nitro-2-[4-(3-phenoxypropylamino)butoxy]phenyl]pyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 2,6-dimethyl-4-[5-nitro-2-[4-(3-phenoxypropylamino)butoxy]phenyl]pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 14580326 |
| Molecular Formula | C30H35N3O8 |
| Molecular Weight | 565.62 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | dimethyl 2,6-dimethyl-4-[5-nitro-2-[4-(3-phenoxypropylamino)butoxy]phenyl]pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)c1c(C)nc(C)c(C(=O)OC)c1-c1cc([N+](=O)[O-])ccc1OCCCCNCCCOc1ccccc1 |
| InChI | InChI=1S/C30H35N3O8/c1-20-26(29(34)38-3)28(27(21(2)32-20)30(35)39-4)24-19-22(33(36)37)13-14-25(24)41-17-9-8-15-31-16-10-18-40-23-11-6-5-7-12-23/h5-7,11-14,19,31H,8-10,15-18H2,1-4H3 |
| InChIKey | OMPISQRHZYZHNT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|