C22H22N4O7 — CID 153449399
methyl 4-[4-(2-methoxyethoxy)phenoxy]-6-methyl-2-(3-nitroanilino)pyrimidine-5-carboxylate (PubChem CID 153449399) has the molecular formula C22H22N4O7 and a molecular weight of 454.44 g/mol. Its IUPAC name is methyl 4-[4-(2-methoxyethoxy)phenoxy]-6-methyl-2-(3-nitroanilino)pyrimidine-5-carboxylate.
| Compound Name | methyl 4-[4-(2-methoxyethoxy)phenoxy]-6-methyl-2-(3-nitroanilino)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 153449399 |
| Molecular Formula | C22H22N4O7 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | methyl 4-[4-(2-methoxyethoxy)phenoxy]-6-methyl-2-(3-nitroanilino)pyrimidine-5-carboxylate |
| SMILES | COCCOc1ccc(Oc2nc(Nc3cccc([N+](=O)[O-])c3)nc(C)c2C(=O)OC)cc1 |
| InChI | InChI=1S/C22H22N4O7/c1-14-19(21(27)31-3)20(33-18-9-7-17(8-10-18)32-12-11-30-2)25-22(23-14)24-15-5-4-6-16(13-15)26(28)29/h4-10,13H,11-12H2,1-3H3,(H,23,24,25) |
| InChIKey | XZHWCTYHJLIBQM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|