C13H14N2O5 — CID 163277239
2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)-4-nitrophenoxy]ethanol (PubChem CID 163277239) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is 2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)-4-nitrophenoxy]ethanol.
| Compound Name | 2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)-4-nitrophenoxy]ethanol |
|---|---|
| PubChem CID | 163277239 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)-4-nitrophenoxy]ethanol |
| SMILES | Cc1noc(C)c1-c1cc([N+](=O)[O-])ccc1OCCO |
| InChI | InChI=1S/C13H14N2O5/c1-8-13(9(2)20-14-8)11-7-10(15(17)18)3-4-12(11)19-6-5-16/h3-4,7,16H,5-6H2,1-2H3 |
| InChIKey | BKFLEGQZWOCDLE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 98.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|