C16H13FN4O3 — CID 176582753
3-(3,5-dimethyl-1,2-oxazol-4-yl)-4-(2-fluoro-4-nitrophenyl)pyridin-2-amine (PubChem CID 176582753) has the molecular formula C16H13FN4O3 and a molecular weight of 328.30 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1,2-oxazol-4-yl)-4-(2-fluoro-4-nitrophenyl)pyridin-2-amine.
| Compound Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)-4-(2-fluoro-4-nitrophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 176582753 |
| Molecular Formula | C16H13FN4O3 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)-4-(2-fluoro-4-nitrophenyl)pyridin-2-amine |
| SMILES | Cc1noc(C)c1-c1c(-c2ccc([N+](=O)[O-])cc2F)ccnc1N |
| InChI | InChI=1S/C16H13FN4O3/c1-8-14(9(2)24-20-8)15-12(5-6-19-16(15)18)11-4-3-10(21(22)23)7-13(11)17/h3-7H,1-2H3,(H2,18,19) |
| InChIKey | YJPJSWRUJDERHJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|