C8H10ClNO — CID 123946881
4-chloro-5-methoxy-2,3-dimethylpyridine (PubChem CID 123946881) has the molecular formula C8H10ClNO and a molecular weight of 171.63 g/mol. Its IUPAC name is 4-chloro-5-methoxy-2,3-dimethylpyridine.
| Compound Name | 4-chloro-5-methoxy-2,3-dimethylpyridine |
|---|---|
| PubChem CID | 123946881 |
| Molecular Formula | C8H10ClNO |
| Molecular Weight | 171.63 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 4-chloro-5-methoxy-2,3-dimethylpyridine |
| SMILES | COc1cnc(C)c(C)c1Cl |
| InChI | InChI=1S/C8H10ClNO/c1-5-6(2)10-4-7(11-3)8(5)9/h4H,1-3H3 |
| InChIKey | VJLAOZRMQCTLDN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.63 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |