C13H11Cl2FN2O3 — CID 166430945
2-chloro-N-(4-chloro-6,7-dimethoxyquinolin-3-yl)-2-fluoroacetamide (PubChem CID 166430945) has the molecular formula C13H11Cl2FN2O3 and a molecular weight of 333.15 g/mol. Its IUPAC name is 2-chloro-N-(4-chloro-6,7-dimethoxyquinolin-3-yl)-2-fluoroacetamide.
| Compound Name | 2-chloro-N-(4-chloro-6,7-dimethoxyquinolin-3-yl)-2-fluoroacetamide |
|---|---|
| PubChem CID | 166430945 |
| Molecular Formula | C13H11Cl2FN2O3 |
| Molecular Weight | 333.15 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 2-chloro-N-(4-chloro-6,7-dimethoxyquinolin-3-yl)-2-fluoroacetamide |
| SMILES | COc1cc2ncc(NC(=O)C(F)Cl)c(Cl)c2cc1OC |
| InChI | InChI=1S/C13H11Cl2FN2O3/c1-20-9-3-6-7(4-10(9)21-2)17-5-8(11(6)14)18-13(19)12(15)16/h3-5,12H,1-2H3,(H,18,19) |
| InChIKey | FXMAKJHAICPJJU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.15 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|