C13H11F3N2O4 — CID 58525533
N-hydroxy-6,7-dimethoxy-4-(trifluoromethyl)quinoline-3-carboxamide (PubChem CID 58525533) has the molecular formula C13H11F3N2O4 and a molecular weight of 316.24 g/mol. Its IUPAC name is N-hydroxy-6,7-dimethoxy-4-(trifluoromethyl)quinoline-3-carboxamide.
| Compound Name | N-hydroxy-6,7-dimethoxy-4-(trifluoromethyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 58525533 |
| Molecular Formula | C13H11F3N2O4 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | N-hydroxy-6,7-dimethoxy-4-(trifluoromethyl)quinoline-3-carboxamide |
| SMILES | COc1cc2ncc(C(=O)NO)c(C(F)(F)F)c2cc1OC |
| InChI | InChI=1S/C13H11F3N2O4/c1-21-9-3-6-8(4-10(9)22-2)17-5-7(12(19)18-20)11(6)13(14,15)16/h3-5,20H,1-2H3,(H,18,19) |
| InChIKey | UGNUGVSVJNOMBX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|