C28H31FN7O4+ — CID 87526639
2-[1-(3-fluorophenyl)-4-[[7-[3-[2-hydroxyethyl(prop-2-ynyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]pyrazol-1-ium-1-yl]acetamide (PubChem CID 87526639) has the molecular formula C28H31FN7O4+ and a molecular weight of 548.60 g/mol. Its IUPAC name is 2-[1-(3-fluorophenyl)-4-[[7-[3-[2-hydroxyethyl(prop-2-ynyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]pyrazol-1-ium-1-yl]acetamide.
| Compound Name | 2-[1-(3-fluorophenyl)-4-[[7-[3-[2-hydroxyethyl(prop-2-ynyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]pyrazol-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 87526639 |
| Molecular Formula | C28H31FN7O4+ |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | 2-[1-(3-fluorophenyl)-4-[[7-[3-[2-hydroxyethyl(prop-2-ynyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]pyrazol-1-ium-1-yl]acetamide |
| SMILES | C#CCN(CCO)CCCOc1cc2ncnc(NC3=C[N+](CC(N)=O)(c4cccc(F)c4)N=C3)c2cc1OC |
| InChI | InChI=1S/C28H30FN7O4/c1-3-8-35(10-11-37)9-5-12-40-26-15-24-23(14-25(26)39-2)28(32-19-31-24)34-21-16-33-36(17-21,18-27(30)38)22-7-4-6-20(29)13-22/h1,4,6-7,13-17,19,37H,5,8-12,18H2,2H3,(H2-,30,31,32,34,38)/p+1 |
| InChIKey | SWBXCOLVMVLHPR-UHFFFAOYSA-O |
| XLogP | 2.22 |
| TPSA | 135.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|