C27H32FN7O3 — CID 91176360
2-(3-fluorophenyl)-2-[4-[[6-methoxy-7-[3-[methyl(propyl)amino]propoxy]quinazolin-4-yl]amino]pyrazol-1-yl]acetamide (PubChem CID 91176360) has the molecular formula C27H32FN7O3 and a molecular weight of 521.60 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-2-[4-[[6-methoxy-7-[3-[methyl(propyl)amino]propoxy]quinazolin-4-yl]amino]pyrazol-1-yl]acetamide.
| Compound Name | 2-(3-fluorophenyl)-2-[4-[[6-methoxy-7-[3-[methyl(propyl)amino]propoxy]quinazolin-4-yl]amino]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 91176360 |
| Molecular Formula | C27H32FN7O3 |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | 2-(3-fluorophenyl)-2-[4-[[6-methoxy-7-[3-[methyl(propyl)amino]propoxy]quinazolin-4-yl]amino]pyrazol-1-yl]acetamide |
| SMILES | CCCN(C)CCCOc1cc2ncnc(Nc3cnn(C(C(N)=O)c4cccc(F)c4)c3)c2cc1OC |
| InChI | InChI=1S/C27H32FN7O3/c1-4-9-34(2)10-6-11-38-24-14-22-21(13-23(24)37-3)27(31-17-30-22)33-20-15-32-35(16-20)25(26(29)36)18-7-5-8-19(28)12-18/h5,7-8,12-17,25H,4,6,9-11H2,1-3H3,(H2,29,36)(H,30,31,33) |
| InChIKey | IYFOEHRURQMABM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|