C29H29F2N7O4 — CID 69324751
N-(2,3-difluorophenyl)-2-[4-[[7-[2-[ethynyl(oxan-4-yl)amino]ethoxy]-6-methoxyquinazolin-4-yl]amino]pyrazol-1-yl]acetamide (PubChem CID 69324751) has the molecular formula C29H29F2N7O4 and a molecular weight of 577.59 g/mol. Its IUPAC name is N-(2,3-difluorophenyl)-2-[4-[[7-[2-[ethynyl(oxan-4-yl)amino]ethoxy]-6-methoxyquinazolin-4-yl]amino]pyrazol-1-yl]acetamide.
| Compound Name | N-(2,3-difluorophenyl)-2-[4-[[7-[2-[ethynyl(oxan-4-yl)amino]ethoxy]-6-methoxyquinazolin-4-yl]amino]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 69324751 |
| Molecular Formula | C29H29F2N7O4 |
| Molecular Weight | 577.59 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | N-(2,3-difluorophenyl)-2-[4-[[7-[2-[ethynyl(oxan-4-yl)amino]ethoxy]-6-methoxyquinazolin-4-yl]amino]pyrazol-1-yl]acetamide |
| SMILES | C#CN(CCOc1cc2ncnc(Nc3cnn(CC(=O)Nc4cccc(F)c4F)c3)c2cc1OC)C1CCOCC1 |
| InChI | InChI=1S/C29H29F2N7O4/c1-3-37(20-7-10-41-11-8-20)9-12-42-26-14-24-21(13-25(26)40-2)29(33-18-32-24)35-19-15-34-38(16-19)17-27(39)36-23-6-4-5-22(30)28(23)31/h1,4-6,13-16,18,20H,7-12,17H2,2H3,(H,36,39)(H,32,33,35) |
| InChIKey | NPSWZJAXLQOHMD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.59 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|