C26H30AsFN6O6P — CID 87641661
CID 87641661 (PubChem CID 87641661) has the molecular formula C26H30AsFN6O6P and a molecular weight of 647.46 g/mol.
| Compound Name | CID 87641661 |
|---|---|
| PubChem CID | 87641661 |
| Molecular Formula | C26H30AsFN6O6P |
| Molecular Weight | 647.46 g/mol |
| Exact Mass | 647.12 |
| IUPAC Name | — |
| SMILES | CCN(CCCOc1ccc2c(Nc3cc(CC(=O)[As]c4cccc(F)c4)[nH]n3)ncnc2c1)CCOP(=O)(O)O |
| InChI | InChI=1S/C26H30AsFN6O6P/c1-2-34(10-12-40-41(36,37)38)9-4-11-39-21-7-8-22-23(16-21)29-17-30-26(22)31-25-15-20(32-33-25)14-24(35)27-18-5-3-6-19(28)13-18/h3,5-8,13,15-17H,2,4,9-12,14H2,1H3,(H2,36,37,38)(H2,29,30,31,32,33) |
| InChIKey | IMFCGXDMYABZKL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 162.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|