C37H53FN7O7P — CID 68663364
ditert-butyl 2-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl-(2-methylpropyl)amino]ethyl phosphate (PubChem CID 68663364) has the molecular formula C37H53FN7O7P and a molecular weight of 757.85 g/mol. Its IUPAC name is ditert-butyl 2-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl-(2-methylpropyl)amino]ethyl phosphate.
| Compound Name | ditert-butyl 2-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl-(2-methylpropyl)amino]ethyl phosphate |
|---|---|
| PubChem CID | 68663364 |
| Molecular Formula | C37H53FN7O7P |
| Molecular Weight | 757.85 g/mol |
| Exact Mass | 757.37 |
| IUPAC Name | ditert-butyl 2-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl-(2-methylpropyl)amino]ethyl phosphate |
| SMILES | COc1cc2c(Nc3cc(CC(=O)Nc4cccc(F)c4)[nH]n3)ncnc2cc1OCCCN(CCOP(=O)(OC(C)(C)C)OC(C)(C)C)CC(C)C |
| InChI | InChI=1S/C37H53FN7O7P/c1-25(2)23-45(15-17-50-53(47,51-36(3,4)5)52-37(6,7)8)14-11-16-49-32-22-30-29(21-31(32)48-9)35(40-24-39-30)42-33-19-28(43-44-33)20-34(46)41-27-13-10-12-26(38)18-27/h10,12-13,18-19,21-22,24-25H,11,14-17,20,23H2,1-9H3,(H,41,46)(H2,39,40,42,43,44) |
| InChIKey | CJNIJTRKIAKXAW-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 162.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.85 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|