C37H51FN7O7P — CID 68662719
ditert-butyl 2-[cyclobutyl-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl]amino]ethyl phosphate (PubChem CID 68662719) has the molecular formula C37H51FN7O7P and a molecular weight of 755.83 g/mol. Its IUPAC name is ditert-butyl 2-[cyclobutyl-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl]amino]ethyl phosphate.
| Compound Name | ditert-butyl 2-[cyclobutyl-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl]amino]ethyl phosphate |
|---|---|
| PubChem CID | 68662719 |
| Molecular Formula | C37H51FN7O7P |
| Molecular Weight | 755.83 g/mol |
| Exact Mass | 755.36 |
| IUPAC Name | ditert-butyl 2-[cyclobutyl-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]-6-methoxyquinazolin-7-yl]oxypropyl]amino]ethyl phosphate |
| SMILES | COc1cc2c(Nc3cc(CC(=O)Nc4cccc(F)c4)[nH]n3)ncnc2cc1OCCCN(CCOP(=O)(OC(C)(C)C)OC(C)(C)C)C1CCC1 |
| InChI | InChI=1S/C37H51FN7O7P/c1-36(2,3)51-53(47,52-37(4,5)6)50-18-16-45(28-13-9-14-28)15-10-17-49-32-23-30-29(22-31(32)48-7)35(40-24-39-30)42-33-20-27(43-44-33)21-34(46)41-26-12-8-11-25(38)19-26/h8,11-12,19-20,22-24,28H,9-10,13-18,21H2,1-7H3,(H,41,46)(H2,39,40,42,43,44) |
| InChIKey | ZCNMHUZBGAQTLZ-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 162.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.83 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|