C30H34FN7O3 — CID 69461840
2-[3-[[7-[3-[2,2-dimethylpropyl(ethynyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]-1H-pyrazol-5-yl]-N-(3-fluorophenyl)acetamide (PubChem CID 69461840) has the molecular formula C30H34FN7O3 and a molecular weight of 559.65 g/mol. Its IUPAC name is 2-[3-[[7-[3-[2,2-dimethylpropyl(ethynyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]-1H-pyrazol-5-yl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[3-[[7-[3-[2,2-dimethylpropyl(ethynyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]-1H-pyrazol-5-yl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 69461840 |
| Molecular Formula | C30H34FN7O3 |
| Molecular Weight | 559.65 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | 2-[3-[[7-[3-[2,2-dimethylpropyl(ethynyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]-1H-pyrazol-5-yl]-N-(3-fluorophenyl)acetamide |
| SMILES | C#CN(CCCOc1cc2ncnc(Nc3cc(CC(=O)Nc4cccc(F)c4)[nH]n3)c2cc1OC)CC(C)(C)C |
| InChI | InChI=1S/C30H34FN7O3/c1-6-38(18-30(2,3)4)11-8-12-41-26-17-24-23(16-25(26)40-5)29(33-19-32-24)35-27-14-22(36-37-27)15-28(39)34-21-10-7-9-20(31)13-21/h1,7,9-10,13-14,16-17,19H,8,11-12,15,18H2,2-5H3,(H,34,39)(H2,32,33,35,36,37) |
| InChIKey | CUPCJPRUZJZKKV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.65 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|