C23H27N5O — CID 91147673
1-[4-[2-[(5,6-diethylpyrimidin-4-yl)amino]ethyl]phenyl]-3-phenylurea (PubChem CID 91147673) has the molecular formula C23H27N5O and a molecular weight of 389.50 g/mol. Its IUPAC name is 1-[4-[2-[(5,6-diethylpyrimidin-4-yl)amino]ethyl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[2-[(5,6-diethylpyrimidin-4-yl)amino]ethyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 91147673 |
| Molecular Formula | C23H27N5O |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 1-[4-[2-[(5,6-diethylpyrimidin-4-yl)amino]ethyl]phenyl]-3-phenylurea |
| SMILES | CCc1ncnc(NCCc2ccc(NC(=O)Nc3ccccc3)cc2)c1CC |
| InChI | InChI=1S/C23H27N5O/c1-3-20-21(4-2)25-16-26-22(20)24-15-14-17-10-12-19(13-11-17)28-23(29)27-18-8-6-5-7-9-18/h5-13,16H,3-4,14-15H2,1-2H3,(H,24,25,26)(H2,27,28,29) |
| InChIKey | NSPVVZSIVATWSZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |