C19H24N3O3- — CID 19392533
4-[2-(4-butoxyphenyl)ethylamino]-6-ethylpyrimidine-5-carboxylate (PubChem CID 19392533) has the molecular formula C19H24N3O3- and a molecular weight of 342.42 g/mol. Its IUPAC name is 4-[2-(4-butoxyphenyl)ethylamino]-6-ethylpyrimidine-5-carboxylate.
| Compound Name | 4-[2-(4-butoxyphenyl)ethylamino]-6-ethylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 19392533 |
| Molecular Formula | C19H24N3O3- |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 4-[2-(4-butoxyphenyl)ethylamino]-6-ethylpyrimidine-5-carboxylate |
| SMILES | CCCCOc1ccc(CCNc2ncnc(CC)c2C(=O)[O-])cc1 |
| InChI | InChI=1S/C19H25N3O3/c1-3-5-12-25-15-8-6-14(7-9-15)10-11-20-18-17(19(23)24)16(4-2)21-13-22-18/h6-9,13H,3-5,10-12H2,1-2H3,(H,23,24)(H,20,21,22)/p-1 |
| InChIKey | IVNVDXNZVRUVON-UHFFFAOYSA-M |
| XLogP | 2.24 |
| TPSA | 87.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|