C21H21Cl2N3O — CID 118344893
5-chloro-N-[2-[4-(3-chloro-5-methylphenoxy)phenyl]ethyl]-6-ethylpyrimidin-4-amine (PubChem CID 118344893) has the molecular formula C21H21Cl2N3O and a molecular weight of 402.33 g/mol. Its IUPAC name is 5-chloro-N-[2-[4-(3-chloro-5-methylphenoxy)phenyl]ethyl]-6-ethylpyrimidin-4-amine.
| Compound Name | 5-chloro-N-[2-[4-(3-chloro-5-methylphenoxy)phenyl]ethyl]-6-ethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 118344893 |
| Molecular Formula | C21H21Cl2N3O |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 5-chloro-N-[2-[4-(3-chloro-5-methylphenoxy)phenyl]ethyl]-6-ethylpyrimidin-4-amine |
| SMILES | CCc1ncnc(NCCc2ccc(Oc3cc(C)cc(Cl)c3)cc2)c1Cl |
| InChI | InChI=1S/C21H21Cl2N3O/c1-3-19-20(23)21(26-13-25-19)24-9-8-15-4-6-17(7-5-15)27-18-11-14(2)10-16(22)12-18/h4-7,10-13H,3,8-9H2,1-2H3,(H,24,25,26) |
| InChIKey | NFFGPGFSTJXWAI-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |