C13H13Cl2FN4 — CID 171782361
5-chloro-N-[2-(5-chloro-3-fluoro-2-pyridinyl)ethyl]-6-ethylpyrimidin-4-amine (PubChem CID 171782361) has the molecular formula C13H13Cl2FN4 and a molecular weight of 315.18 g/mol. Its IUPAC name is 5-chloro-N-[2-(5-chloro-3-fluoro-2-pyridinyl)ethyl]-6-ethylpyrimidin-4-amine.
| Compound Name | 5-chloro-N-[2-(5-chloro-3-fluoro-2-pyridinyl)ethyl]-6-ethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 171782361 |
| Molecular Formula | C13H13Cl2FN4 |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 5-chloro-N-[2-(5-chloro-3-fluoro-2-pyridinyl)ethyl]-6-ethylpyrimidin-4-amine |
| SMILES | CCc1ncnc(NCCc2ncc(Cl)cc2F)c1Cl |
| InChI | InChI=1S/C13H13Cl2FN4/c1-2-10-12(15)13(20-7-19-10)17-4-3-11-9(16)5-8(14)6-18-11/h5-7H,2-4H2,1H3,(H,17,19,20) |
| InChIKey | UCSFVPBPXCOBLK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |