C20H20ClN3O — CID 144611754
5-chloro-6-methyl-N-[2-[4-(4-methylphenoxy)phenyl]ethyl]pyrimidin-4-amine (PubChem CID 144611754) has the molecular formula C20H20ClN3O and a molecular weight of 353.85 g/mol. Its IUPAC name is 5-chloro-6-methyl-N-[2-[4-(4-methylphenoxy)phenyl]ethyl]pyrimidin-4-amine.
| Compound Name | 5-chloro-6-methyl-N-[2-[4-(4-methylphenoxy)phenyl]ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 144611754 |
| Molecular Formula | C20H20ClN3O |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 5-chloro-6-methyl-N-[2-[4-(4-methylphenoxy)phenyl]ethyl]pyrimidin-4-amine |
| SMILES | Cc1ccc(Oc2ccc(CCNc3ncnc(C)c3Cl)cc2)cc1 |
| InChI | InChI=1S/C20H20ClN3O/c1-14-3-7-17(8-4-14)25-18-9-5-16(6-10-18)11-12-22-20-19(21)15(2)23-13-24-20/h3-10,13H,11-12H2,1-2H3,(H,22,23,24) |
| InChIKey | QNLGEYZHULLYEE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |