C15H14ClF4N3O — CID 11079009
5-chloro-6-(1-fluoroethyl)-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]pyrimidin-4-amine (PubChem CID 11079009) has the molecular formula C15H14ClF4N3O and a molecular weight of 363.74 g/mol. Its IUPAC name is 5-chloro-6-(1-fluoroethyl)-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]pyrimidin-4-amine.
| Compound Name | 5-chloro-6-(1-fluoroethyl)-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 11079009 |
| Molecular Formula | C15H14ClF4N3O |
| Molecular Weight | 363.74 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 5-chloro-6-(1-fluoroethyl)-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]pyrimidin-4-amine |
| SMILES | CC(F)c1ncnc(NCCc2ccc(OC(F)(F)F)cc2)c1Cl |
| InChI | InChI=1S/C15H14ClF4N3O/c1-9(17)13-12(16)14(23-8-22-13)21-7-6-10-2-4-11(5-3-10)24-15(18,19)20/h2-5,8-9H,6-7H2,1H3,(H,21,22,23) |
| InChIKey | GJEREQYJIQASAW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.74 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |