C19H17Cl3N4O — CID 90131265
5-chloro-N-[2-[4-[(4,6-dichloro-3-pyridinyl)oxy]phenyl]ethyl]-2,6-dimethylpyrimidin-4-amine (PubChem CID 90131265) has the molecular formula C19H17Cl3N4O and a molecular weight of 423.73 g/mol. Its IUPAC name is 5-chloro-N-[2-[4-[(4,6-dichloro-3-pyridinyl)oxy]phenyl]ethyl]-2,6-dimethylpyrimidin-4-amine.
| Compound Name | 5-chloro-N-[2-[4-[(4,6-dichloro-3-pyridinyl)oxy]phenyl]ethyl]-2,6-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 90131265 |
| Molecular Formula | C19H17Cl3N4O |
| Molecular Weight | 423.73 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 5-chloro-N-[2-[4-[(4,6-dichloro-3-pyridinyl)oxy]phenyl]ethyl]-2,6-dimethylpyrimidin-4-amine |
| SMILES | Cc1nc(C)c(Cl)c(NCCc2ccc(Oc3cnc(Cl)cc3Cl)cc2)n1 |
| InChI | InChI=1S/C19H17Cl3N4O/c1-11-18(22)19(26-12(2)25-11)23-8-7-13-3-5-14(6-4-13)27-16-10-24-17(21)9-15(16)20/h3-6,9-10H,7-8H2,1-2H3,(H,23,25,26) |
| InChIKey | GEUDBFWIJXPATR-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.73 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|