C14H15Cl2FN4O — CID 162513972
5-chloro-N-[3-[(5-chloro-3-fluoro-2-pyridinyl)oxy]propyl]-2,6-dimethylpyrimidin-4-amine (PubChem CID 162513972) has the molecular formula C14H15Cl2FN4O and a molecular weight of 345.21 g/mol. Its IUPAC name is 5-chloro-N-[3-[(5-chloro-3-fluoro-2-pyridinyl)oxy]propyl]-2,6-dimethylpyrimidin-4-amine.
| Compound Name | 5-chloro-N-[3-[(5-chloro-3-fluoro-2-pyridinyl)oxy]propyl]-2,6-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 162513972 |
| Molecular Formula | C14H15Cl2FN4O |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 5-chloro-N-[3-[(5-chloro-3-fluoro-2-pyridinyl)oxy]propyl]-2,6-dimethylpyrimidin-4-amine |
| SMILES | Cc1nc(C)c(Cl)c(NCCCOc2ncc(Cl)cc2F)n1 |
| InChI | InChI=1S/C14H15Cl2FN4O/c1-8-12(16)13(21-9(2)20-8)18-4-3-5-22-14-11(17)6-10(15)7-19-14/h6-7H,3-5H2,1-2H3,(H,18,20,21) |
| InChIKey | ZDFJOSGROIHYGH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|