C13H11Cl2F3N4O — CID 162513998
5-chloro-N-[2-[(5-chloro-3-fluoro-2-pyridinyl)oxy]ethyl]-6-(difluoromethyl)-2-methylpyrimidin-4-amine (PubChem CID 162513998) has the molecular formula C13H11Cl2F3N4O and a molecular weight of 367.16 g/mol. Its IUPAC name is 5-chloro-N-[2-[(5-chloro-3-fluoro-2-pyridinyl)oxy]ethyl]-6-(difluoromethyl)-2-methylpyrimidin-4-amine.
| Compound Name | 5-chloro-N-[2-[(5-chloro-3-fluoro-2-pyridinyl)oxy]ethyl]-6-(difluoromethyl)-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 162513998 |
| Molecular Formula | C13H11Cl2F3N4O |
| Molecular Weight | 367.16 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 5-chloro-N-[2-[(5-chloro-3-fluoro-2-pyridinyl)oxy]ethyl]-6-(difluoromethyl)-2-methylpyrimidin-4-amine |
| SMILES | Cc1nc(NCCOc2ncc(Cl)cc2F)c(Cl)c(C(F)F)n1 |
| InChI | InChI=1S/C13H11Cl2F3N4O/c1-6-21-10(11(17)18)9(15)12(22-6)19-2-3-23-13-8(16)4-7(14)5-20-13/h4-5,11H,2-3H2,1H3,(H,19,21,22) |
| InChIKey | YZBOOWVQPCMKPH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.16 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|