C20H27N3O3 — CID 22407589
methyl 4-[2-(4-butoxyphenyl)ethylamino]-6-ethylpyrimidine-5-carboxylate (PubChem CID 22407589) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is methyl 4-[2-(4-butoxyphenyl)ethylamino]-6-ethylpyrimidine-5-carboxylate.
| Compound Name | methyl 4-[2-(4-butoxyphenyl)ethylamino]-6-ethylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 22407589 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | methyl 4-[2-(4-butoxyphenyl)ethylamino]-6-ethylpyrimidine-5-carboxylate |
| SMILES | CCCCOc1ccc(CCNc2ncnc(CC)c2C(=O)OC)cc1 |
| InChI | InChI=1S/C20H27N3O3/c1-4-6-13-26-16-9-7-15(8-10-16)11-12-21-19-18(20(24)25-3)17(5-2)22-14-23-19/h7-10,14H,4-6,11-13H2,1-3H3,(H,21,22,23) |
| InChIKey | JHJGIOJABBBULD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|