C27H34F2N6O2 — CID 171419908
1-(3-fluoro-3-methylbutyl)-3-[4-[[5-fluoro-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]amino]phenyl]urea (PubChem CID 171419908) has the molecular formula C27H34F2N6O2 and a molecular weight of 512.61 g/mol. Its IUPAC name is 1-(3-fluoro-3-methylbutyl)-3-[4-[[5-fluoro-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]amino]phenyl]urea.
| Compound Name | 1-(3-fluoro-3-methylbutyl)-3-[4-[[5-fluoro-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]amino]phenyl]urea |
|---|---|
| PubChem CID | 171419908 |
| Molecular Formula | C27H34F2N6O2 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | 1-(3-fluoro-3-methylbutyl)-3-[4-[[5-fluoro-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]amino]phenyl]urea |
| SMILES | CC(C)(F)CCNC(=O)Nc1ccc(Nc2ncnc3cc(OCCCN4CCCC4)cc(F)c23)cc1 |
| InChI | InChI=1S/C27H34F2N6O2/c1-27(2,29)10-11-30-26(36)34-20-8-6-19(7-9-20)33-25-24-22(28)16-21(17-23(24)31-18-32-25)37-15-5-14-35-12-3-4-13-35/h6-9,16-18H,3-5,10-15H2,1-2H3,(H2,30,34,36)(H,31,32,33) |
| InChIKey | RRYWFLONYBBNPB-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|