C24H26F2N6O3 — CID 171419844
1-(3-cyano-3-methylbutyl)-3-[3-fluoro-4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]urea (PubChem CID 171419844) has the molecular formula C24H26F2N6O3 and a molecular weight of 484.51 g/mol. Its IUPAC name is 1-(3-cyano-3-methylbutyl)-3-[3-fluoro-4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]urea.
| Compound Name | 1-(3-cyano-3-methylbutyl)-3-[3-fluoro-4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]urea |
|---|---|
| PubChem CID | 171419844 |
| Molecular Formula | C24H26F2N6O3 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 1-(3-cyano-3-methylbutyl)-3-[3-fluoro-4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]urea |
| SMILES | COCCOc1cc(F)c2c(Nc3ccc(NC(=O)NCCC(C)(C)C#N)cc3F)ncnc2c1 |
| InChI | InChI=1S/C24H26F2N6O3/c1-24(2,13-27)6-7-28-23(33)31-15-4-5-19(17(25)10-15)32-22-21-18(26)11-16(35-9-8-34-3)12-20(21)29-14-30-22/h4-5,10-12,14H,6-9H2,1-3H3,(H2,28,31,33)(H,29,30,32) |
| InChIKey | JJZNUTXUWQIJGR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|