C24H28FN5O4 — CID 171419925
N-[2-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]anilino]-2-oxoethyl]-N,2-dimethylpropanamide (PubChem CID 171419925) has the molecular formula C24H28FN5O4 and a molecular weight of 469.52 g/mol. Its IUPAC name is N-[2-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]anilino]-2-oxoethyl]-N,2-dimethylpropanamide.
| Compound Name | N-[2-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]anilino]-2-oxoethyl]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 171419925 |
| Molecular Formula | C24H28FN5O4 |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | N-[2-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]anilino]-2-oxoethyl]-N,2-dimethylpropanamide |
| SMILES | COCCOc1cc(F)c2c(Nc3ccc(NC(=O)CN(C)C(=O)C(C)C)cc3)ncnc2c1 |
| InChI | InChI=1S/C24H28FN5O4/c1-15(2)24(32)30(3)13-21(31)28-16-5-7-17(8-6-16)29-23-22-19(25)11-18(34-10-9-33-4)12-20(22)26-14-27-23/h5-8,11-12,14-15H,9-10,13H2,1-4H3,(H,28,31)(H,26,27,29) |
| InChIKey | OQGREQBPCXYZGU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|