C23H24FN5O5 — CID 171419788
N'-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-N-(oxetan-3-yl)propanediamide (PubChem CID 171419788) has the molecular formula C23H24FN5O5 and a molecular weight of 469.47 g/mol. Its IUPAC name is N'-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-N-(oxetan-3-yl)propanediamide.
| Compound Name | N'-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-N-(oxetan-3-yl)propanediamide |
|---|---|
| PubChem CID | 171419788 |
| Molecular Formula | C23H24FN5O5 |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | N'-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-N-(oxetan-3-yl)propanediamide |
| SMILES | COCCOc1cc(F)c2c(Nc3ccc(NC(=O)CC(=O)NC4COC4)cc3)ncnc2c1 |
| InChI | InChI=1S/C23H24FN5O5/c1-32-6-7-34-17-8-18(24)22-19(9-17)25-13-26-23(22)29-15-4-2-14(3-5-15)27-20(30)10-21(31)28-16-11-33-12-16/h2-5,8-9,13,16H,6-7,10-12H2,1H3,(H,27,30)(H,28,31)(H,25,26,29) |
| InChIKey | NHYLEVJOSMZWHY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 123.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|