C21H21FN4O5 — CID 168927366
methyl 3-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]anilino]-3-oxopropanoate (PubChem CID 168927366) has the molecular formula C21H21FN4O5 and a molecular weight of 428.42 g/mol. Its IUPAC name is methyl 3-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]anilino]-3-oxopropanoate.
| Compound Name | methyl 3-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]anilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 168927366 |
| Molecular Formula | C21H21FN4O5 |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | methyl 3-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]anilino]-3-oxopropanoate |
| SMILES | COCCOc1cc(F)c2c(Nc3ccc(NC(=O)CC(=O)OC)cc3)ncnc2c1 |
| InChI | InChI=1S/C21H21FN4O5/c1-29-7-8-31-15-9-16(22)20-17(10-15)23-12-24-21(20)26-14-5-3-13(4-6-14)25-18(27)11-19(28)30-2/h3-6,9-10,12H,7-8,11H2,1-2H3,(H,25,27)(H,23,24,26) |
| InChIKey | VWXBEIBBLMKLHT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|