C26H32FN5O3 — CID 171419946
3-tert-butyl-N-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]pyrrolidine-1-carboxamide (PubChem CID 171419946) has the molecular formula C26H32FN5O3 and a molecular weight of 481.57 g/mol. Its IUPAC name is 3-tert-butyl-N-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | 3-tert-butyl-N-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 171419946 |
| Molecular Formula | C26H32FN5O3 |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 3-tert-butyl-N-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]pyrrolidine-1-carboxamide |
| SMILES | COCCOc1cc(F)c2c(Nc3ccc(NC(=O)N4CCC(C(C)(C)C)C4)cc3)ncnc2c1 |
| InChI | InChI=1S/C26H32FN5O3/c1-26(2,3)17-9-10-32(15-17)25(33)31-19-7-5-18(6-8-19)30-24-23-21(27)13-20(35-12-11-34-4)14-22(23)28-16-29-24/h5-8,13-14,16-17H,9-12,15H2,1-4H3,(H,31,33)(H,28,29,30) |
| InChIKey | QSLSXFNIEOCNDY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|