C28H37FN4O3 — CID 168926823
3-tert-butyl-N-[4-[1-[2-(ethylideneamino)-6-fluoro-4-(2-methoxyethoxy)phenyl]ethenylamino]phenyl]pyrrolidine-1-carboxamide (PubChem CID 168926823) has the molecular formula C28H37FN4O3 and a molecular weight of 496.63 g/mol. Its IUPAC name is 3-tert-butyl-N-[4-[1-[2-(ethylideneamino)-6-fluoro-4-(2-methoxyethoxy)phenyl]ethenylamino]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | 3-tert-butyl-N-[4-[1-[2-(ethylideneamino)-6-fluoro-4-(2-methoxyethoxy)phenyl]ethenylamino]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 168926823 |
| Molecular Formula | C28H37FN4O3 |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | 3-tert-butyl-N-[4-[1-[2-(ethylideneamino)-6-fluoro-4-(2-methoxyethoxy)phenyl]ethenylamino]phenyl]pyrrolidine-1-carboxamide |
| SMILES | C=C(Nc1ccc(NC(=O)N2CCC(C(C)(C)C)C2)cc1)c1c(F)cc(OCCOC)cc1/N=C/C |
| InChI | InChI=1S/C28H37FN4O3/c1-7-30-25-17-23(36-15-14-35-6)16-24(29)26(25)19(2)31-21-8-10-22(11-9-21)32-27(34)33-13-12-20(18-33)28(3,4)5/h7-11,16-17,20,31H,2,12-15,18H2,1,3-6H3,(H,32,34)/b30-7+ |
| InChIKey | PPBTXUZKDAHGON-YRICHZAJSA-N |
| XLogP | 6.56 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|