C26H32FN3O5 — CID 168926953
N-[4-[1-[2-(ethylideneamino)-6-fluoro-4-(2-methoxyethoxy)phenyl]ethenylamino]phenyl]-2-(oxolan-2-ylmethoxy)acetamide (PubChem CID 168926953) has the molecular formula C26H32FN3O5 and a molecular weight of 485.56 g/mol. Its IUPAC name is N-[4-[1-[2-(ethylideneamino)-6-fluoro-4-(2-methoxyethoxy)phenyl]ethenylamino]phenyl]-2-(oxolan-2-ylmethoxy)acetamide.
| Compound Name | N-[4-[1-[2-(ethylideneamino)-6-fluoro-4-(2-methoxyethoxy)phenyl]ethenylamino]phenyl]-2-(oxolan-2-ylmethoxy)acetamide |
|---|---|
| PubChem CID | 168926953 |
| Molecular Formula | C26H32FN3O5 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | N-[4-[1-[2-(ethylideneamino)-6-fluoro-4-(2-methoxyethoxy)phenyl]ethenylamino]phenyl]-2-(oxolan-2-ylmethoxy)acetamide |
| SMILES | C=C(Nc1ccc(NC(=O)COCC2CCCO2)cc1)c1c(F)cc(OCCOC)cc1/N=C/C |
| InChI | InChI=1S/C26H32FN3O5/c1-4-28-24-15-22(35-13-12-32-3)14-23(27)26(24)18(2)29-19-7-9-20(10-8-19)30-25(31)17-33-16-21-6-5-11-34-21/h4,7-10,14-15,21,29H,2,5-6,11-13,16-17H2,1,3H3,(H,30,31)/b28-4+ |
| InChIKey | ZDXHAIFYDHNRMR-KLCRIKRISA-N |
| XLogP | 4.79 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|